About cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol
cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol (PubChem CID 156720236) has the molecular formula C19H42N2O2
and a molecular weight of 330.56 g/mol. Its IUPAC name is cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol.
Molecular Properties
| Compound Name | cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol |
| PubChem CID | 156720236 |
| Molecular Formula | C19H42N2O2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.32 |
| IUPAC Name | cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol |
| SMILES | CC.CC.OC1CCC(NC2CCNCC2)CC1.OC1CCC1 |
| InChI | InChI=1S/C11H22N2O.C4H8O.2C2H6/c14-11-3-1-9(2-4-11)13-10-5-7-12-8-6-10;5-4-2-1-3-4;2*1-2/h9-14H,1-8H2;4-5H,1-3H2;2*1-2H3 |
| InChIKey | YMUFKEVFBICJDF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol?
The IUPAC name of cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol (CID 156720236) is cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol.
What is the SMILES notation for cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol?
The canonical SMILES for cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol is CC.CC.OC1CCC(NC2CCNCC2)CC1.OC1CCC1.
What is the InChIKey of cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol?
The InChIKey is YMUFKEVFBICJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O.C4H8O.2C2H6/c14-11-3-1-9(2-4-11)13-10-5-7-12-8-6-10;5-4-2-1-3-4;2*1-2/h9-14H,1-8H2;4-5H,1-3H2;2*1-2H3.
What are the key properties of cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol?
cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol has a molecular weight of 330.56 g/mol, XLogP of 3.22, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutanol;ethane;4-(piperidin-4-ylamino)cyclohexan-1-ol is sourced from PubChem (CID 156720236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).