About 5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine
5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine (PubChem CID 156720532) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine |
| PubChem CID | 156720532 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine |
| SMILES | CCC/C=C(\C)C1=CN=C(N)CC1 |
| InChI | InChI=1S/C11H18N2/c1-3-4-5-9(2)10-6-7-11(12)13-8-10/h5,8H,3-4,6-7H2,1-2H3,(H2,12,13)/b9-5+ |
| InChIKey | WJHUTCGYTVNQOY-WEVVVXLNSA-N |
| XLogP | 2.77 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine?
The IUPAC name of 5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine (CID 156720532) is 5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine.
What is the SMILES notation for 5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine?
The canonical SMILES for 5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine is CCC/C=C(\C)C1=CN=C(N)CC1.
What is the InChIKey of 5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine?
The InChIKey is WJHUTCGYTVNQOY-WEVVVXLNSA-N. The full InChI is InChI=1S/C11H18N2/c1-3-4-5-9(2)10-6-7-11(12)13-8-10/h5,8H,3-4,6-7H2,1-2H3,(H2,12,13)/b9-5+.
What are the key properties of 5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine?
5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine has a molecular weight of 178.28 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-hex-2-en-2-yl]-3,4-dihydropyridin-2-amine is sourced from PubChem (CID 156720532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).