About 6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane
6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane (PubChem CID 156721310) has the molecular formula C19H30BrN5O
and a molecular weight of 424.39 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane.
Molecular Properties
| Compound Name | 6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane |
| PubChem CID | 156721310 |
| Molecular Formula | C19H30BrN5O |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane |
| SMILES | CC1CNCCNC1.CCCCc1nc2ncc(Br)cc2c(=O)n1CC |
| InChI | InChI=1S/C13H16BrN3O.C6H14N2/c1-3-5-6-11-16-12-10(7-9(14)8-15-12)13(18)17(11)4-2;1-6-4-7-2-3-8-5-6/h7-8H,3-6H2,1-2H3;6-8H,2-5H2,1H3 |
| InChIKey | MTLATXWZDFWPSR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane?
The IUPAC name of 6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane (CID 156721310) is 6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane.
What is the SMILES notation for 6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane?
The canonical SMILES for 6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane is CC1CNCCNC1.CCCCc1nc2ncc(Br)cc2c(=O)n1CC.
What is the InChIKey of 6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane?
The InChIKey is MTLATXWZDFWPSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrN3O.C6H14N2/c1-3-5-6-11-16-12-10(7-9(14)8-15-12)13(18)17(11)4-2;1-6-4-7-2-3-8-5-6/h7-8H,3-6H2,1-2H3;6-8H,2-5H2,1H3.
What are the key properties of 6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane?
6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane has a molecular weight of 424.39 g/mol, XLogP of 2.73, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-butyl-3-ethylpyrido[2,3-d]pyrimidin-4-one;6-methyl-1,4-diazepane is sourced from PubChem (CID 156721310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).