About ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane
ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane (PubChem CID 156721840) has the molecular formula C15H39N2OP
and a molecular weight of 294.46 g/mol. Its IUPAC name is ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane |
| PubChem CID | 156721840 |
| Molecular Formula | C15H39N2OP |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane |
| SMILES | CC.CC.CCN1CCN(CC(C)COC)CC1.P |
| InChI | InChI=1S/C11H24N2O.2C2H6.H3P/c1-4-12-5-7-13(8-6-12)9-11(2)10-14-3;2*1-2;/h11H,4-10H2,1-3H3;2*1-2H3;1H3 |
| InChIKey | LZEXXUQFXOXWEB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane?
The IUPAC name of ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane (CID 156721840) is ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane.
What is the SMILES notation for ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane?
The canonical SMILES for ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane is CC.CC.CCN1CCN(CC(C)COC)CC1.P.
What is the InChIKey of ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane?
The InChIKey is LZEXXUQFXOXWEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O.2C2H6.H3P/c1-4-12-5-7-13(8-6-12)9-11(2)10-14-3;2*1-2;/h11H,4-10H2,1-3H3;2*1-2H3;1H3.
What are the key properties of ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane?
ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane has a molecular weight of 294.46 g/mol, XLogP of 3.02, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-(3-methoxy-2-methylpropyl)piperazine;phosphane is sourced from PubChem (CID 156721840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).