About tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane
tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane (PubChem CID 156721985) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane.
Molecular Properties
| Compound Name | tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane |
| PubChem CID | 156721985 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane |
| SMILES | CC.CC(=O)C1C=CN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C12H19NO3.C2H6/c1-9(14)10-5-7-13(8-6-10)11(15)16-12(2,3)4;1-2/h5,7,10H,6,8H2,1-4H3;1-2H3 |
| InChIKey | WFXWJIVOYSDAMJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane?
The IUPAC name of tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane (CID 156721985) is tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane.
What is the SMILES notation for tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane?
The canonical SMILES for tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane is CC.CC(=O)C1C=CN(C(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane?
The InChIKey is WFXWJIVOYSDAMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3.C2H6/c1-9(14)10-5-7-13(8-6-10)11(15)16-12(2,3)4;1-2/h5,7,10H,6,8H2,1-4H3;1-2H3.
What are the key properties of tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane?
tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane has a molecular weight of 255.36 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-acetyl-3,4-dihydro-2H-pyridine-1-carboxylate;ethane is sourced from PubChem (CID 156721985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).