About [(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium
[(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium (PubChem CID 156722210) has the molecular formula C8H13F2N2+
and a molecular weight of 175.20 g/mol. Its IUPAC name is [(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium.
Molecular Properties
| Compound Name | [(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium |
| PubChem CID | 156722210 |
| Molecular Formula | C8H13F2N2+ |
| Molecular Weight | 175.20 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | [(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium |
| SMILES | C=C(C)C(F)(F)C(=[NH2+])/C=C(/C)N |
| InChI | InChI=1S/C8H12F2N2/c1-5(2)8(9,10)7(12)4-6(3)11/h4,12H,1,11H2,2-3H3/p+1/b6-4-,12-7? |
| InChIKey | RUZCHBZNZZMIMA-RJJAQFINSA-O |
| XLogP | 0.26 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.20 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium?
The IUPAC name of [(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium (CID 156722210) is [(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium.
What is the SMILES notation for [(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium?
The canonical SMILES for [(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium is C=C(C)C(F)(F)C(=[NH2+])/C=C(/C)N.
What is the InChIKey of [(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium?
The InChIKey is RUZCHBZNZZMIMA-RJJAQFINSA-O. The full InChI is InChI=1S/C8H12F2N2/c1-5(2)8(9,10)7(12)4-6(3)11/h4,12H,1,11H2,2-3H3/p+1/b6-4-,12-7?.
What are the key properties of [(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium?
[(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium has a molecular weight of 175.20 g/mol, XLogP of 0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(5Z)-6-amino-3,3-difluoro-2-methylhepta-1,5-dien-4-ylidene]azanium is sourced from PubChem (CID 156722210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).