About 4-fluoro-2,2-dimethyloxolane
4-fluoro-2,2-dimethyloxolane (PubChem CID 156722292) has the molecular formula C6H11FO
and a molecular weight of 118.15 g/mol. Its IUPAC name is 4-fluoro-2,2-dimethyloxolane.
Molecular Properties
| Compound Name | 4-fluoro-2,2-dimethyloxolane |
| PubChem CID | 156722292 |
| Molecular Formula | C6H11FO |
| Molecular Weight | 118.15 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | 4-fluoro-2,2-dimethyloxolane |
| SMILES | CC1(C)CC(F)CO1 |
| InChI | InChI=1S/C6H11FO/c1-6(2)3-5(7)4-8-6/h5H,3-4H2,1-2H3 |
| InChIKey | MDXBPXVSQMZCOD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.15 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-2,2-dimethyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2,2-dimethyloxolane?
The IUPAC name of 4-fluoro-2,2-dimethyloxolane (CID 156722292) is 4-fluoro-2,2-dimethyloxolane.
What is the SMILES notation for 4-fluoro-2,2-dimethyloxolane?
The canonical SMILES for 4-fluoro-2,2-dimethyloxolane is CC1(C)CC(F)CO1.
What is the InChIKey of 4-fluoro-2,2-dimethyloxolane?
The InChIKey is MDXBPXVSQMZCOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FO/c1-6(2)3-5(7)4-8-6/h5H,3-4H2,1-2H3.
What are the key properties of 4-fluoro-2,2-dimethyloxolane?
4-fluoro-2,2-dimethyloxolane has a molecular weight of 118.15 g/mol, XLogP of 1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2,2-dimethyloxolane is sourced from PubChem (CID 156722292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).