C16H22O3Si — CID 156722617
(3aR,4S,5R,6aS)-5-[dimethyl(phenyl)silyl]-4-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 156722617) has the molecular formula C16H22O3Si and a molecular weight of 290.43 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-5-[dimethyl(phenyl)silyl]-4-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5R,6aS)-5-[dimethyl(phenyl)silyl]-4-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 156722617 |
| Molecular Formula | C16H22O3Si |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (3aR,4S,5R,6aS)-5-[dimethyl(phenyl)silyl]-4-(hydroxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | C[Si](C)(c1ccccc1)[C@@H]1C[C@@H]2OC(=O)C[C@@H]2[C@H]1CO |
| InChI | InChI=1S/C16H22O3Si/c1-20(2,11-6-4-3-5-7-11)15-9-14-12(13(15)10-17)8-16(18)19-14/h3-7,12-15,17H,8-10H2,1-2H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | RJADVYKUCOJDOJ-APIJFGDWSA-N |
| XLogP | 1.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|