About [2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite
[2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite (PubChem CID 156722744) has the molecular formula C12H13Cl2FN2O2S
and a molecular weight of 339.22 g/mol. Its IUPAC name is [2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite.
Molecular Properties
| Compound Name | [2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite |
| PubChem CID | 156722744 |
| Molecular Formula | C12H13Cl2FN2O2S |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | [2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite |
| SMILES | NC(=O)C1CNCCC1c1cc(Cl)c(Cl)cc1OSF |
| InChI | InChI=1S/C12H13Cl2FN2O2S/c13-9-3-7(11(19-20-15)4-10(9)14)6-1-2-17-5-8(6)12(16)18/h3-4,6,8,17H,1-2,5H2,(H2,16,18) |
| InChIKey | KAQMOQZERPRSTC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite?
The IUPAC name of [2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite (CID 156722744) is [2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite.
What is the SMILES notation for [2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite?
The canonical SMILES for [2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite is NC(=O)C1CNCCC1c1cc(Cl)c(Cl)cc1OSF.
What is the InChIKey of [2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite?
The InChIKey is KAQMOQZERPRSTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2FN2O2S/c13-9-3-7(11(19-20-15)4-10(9)14)6-1-2-17-5-8(6)12(16)18/h3-4,6,8,17H,1-2,5H2,(H2,16,18).
What are the key properties of [2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite?
[2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite has a molecular weight of 339.22 g/mol, XLogP of 3.08, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-carbamoylpiperidin-4-yl)-4,5-dichlorophenoxy] thiohypofluorite is sourced from PubChem (CID 156722744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).