About 3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde
3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde (PubChem CID 156722853) has the molecular formula C19H28Cl2N2O3
and a molecular weight of 403.35 g/mol. Its IUPAC name is 3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde.
Molecular Properties
| Compound Name | 3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde |
| PubChem CID | 156722853 |
| Molecular Formula | C19H28Cl2N2O3 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde |
| SMILES | CC.O=CN1CCC[C@H]1C(=O)N1CCCCC1.Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H18N2O2.C6H4Cl2O.C2H6/c14-9-13-8-4-5-10(13)11(15)12-6-2-1-3-7-12;7-5-2-1-4(9)3-6(5)8;1-2/h9-10H,1-8H2;1-3,9H;1-2H3/t10-;;/m0../s1 |
| InChIKey | FXNMHWSKMWEDML-XRIOVQLTSA-N |
| XLogP | 4.34 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde?
The IUPAC name of 3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde (CID 156722853) is 3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde.
What is the SMILES notation for 3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde?
The canonical SMILES for 3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde is CC.O=CN1CCC[C@H]1C(=O)N1CCCCC1.Oc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde?
The InChIKey is FXNMHWSKMWEDML-XRIOVQLTSA-N. The full InChI is InChI=1S/C11H18N2O2.C6H4Cl2O.C2H6/c14-9-13-8-4-5-10(13)11(15)12-6-2-1-3-7-12;7-5-2-1-4(9)3-6(5)8;1-2/h9-10H,1-8H2;1-3,9H;1-2H3/t10-;;/m0../s1.
What are the key properties of 3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde?
3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde has a molecular weight of 403.35 g/mol, XLogP of 4.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dichlorophenol;ethane;(2S)-2-(piperidine-1-carbonyl)pyrrolidine-1-carbaldehyde is sourced from PubChem (CID 156722853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).