About 4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol
4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol (PubChem CID 156723163) has the molecular formula C14H19Cl2NO
and a molecular weight of 288.22 g/mol. Its IUPAC name is 4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol.
Molecular Properties
| Compound Name | 4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol |
| PubChem CID | 156723163 |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol |
| SMILES | CC1(C)CC(Cc2cc(Cl)c(Cl)cc2O)CCN1 |
| InChI | InChI=1S/C14H19Cl2NO/c1-14(2)8-9(3-4-17-14)5-10-6-11(15)12(16)7-13(10)18/h6-7,9,17-18H,3-5,8H2,1-2H3 |
| InChIKey | IKBFFTBCTQUKEA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol?
The IUPAC name of 4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol (CID 156723163) is 4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol.
What is the SMILES notation for 4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol?
The canonical SMILES for 4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol is CC1(C)CC(Cc2cc(Cl)c(Cl)cc2O)CCN1.
What is the InChIKey of 4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol?
The InChIKey is IKBFFTBCTQUKEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19Cl2NO/c1-14(2)8-9(3-4-17-14)5-10-6-11(15)12(16)7-13(10)18/h6-7,9,17-18H,3-5,8H2,1-2H3.
What are the key properties of 4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol?
4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol has a molecular weight of 288.22 g/mol, XLogP of 4.02, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-[(2,2-dimethylpiperidin-4-yl)methyl]phenol is sourced from PubChem (CID 156723163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).