About 2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol
2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol (PubChem CID 156723212) has the molecular formula C19H30Cl2N2O2S
and a molecular weight of 421.43 g/mol. Its IUPAC name is 2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol.
Molecular Properties
| Compound Name | 2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol |
| PubChem CID | 156723212 |
| Molecular Formula | C19H30Cl2N2O2S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol |
| SMILES | COCCN1CCC(C(NSC(C)(C)C)c2cc(Cl)c(Cl)cc2O)CC1 |
| InChI | InChI=1S/C19H30Cl2N2O2S/c1-19(2,3)26-22-18(14-11-15(20)16(21)12-17(14)24)13-5-7-23(8-6-13)9-10-25-4/h11-13,18,22,24H,5-10H2,1-4H3 |
| InChIKey | OHODBQYKZXPGFI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol?
The IUPAC name of 2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol (CID 156723212) is 2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol.
What is the SMILES notation for 2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol?
The canonical SMILES for 2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol is COCCN1CCC(C(NSC(C)(C)C)c2cc(Cl)c(Cl)cc2O)CC1.
What is the InChIKey of 2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol?
The InChIKey is OHODBQYKZXPGFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30Cl2N2O2S/c1-19(2,3)26-22-18(14-11-15(20)16(21)12-17(14)24)13-5-7-23(8-6-13)9-10-25-4/h11-13,18,22,24H,5-10H2,1-4H3.
What are the key properties of 2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol?
2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol has a molecular weight of 421.43 g/mol, XLogP of 5.13, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(tert-butylsulfanylamino)-[1-(2-methoxyethyl)piperidin-4-yl]methyl]-4,5-dichlorophenol is sourced from PubChem (CID 156723212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).