C26H42Cl2N4O3S — CID 156723274
N-tert-butylsulfanyl-1-(4,5-dichloro-2-prop-2-enoxyphenyl)-1-(1-methylpiperidin-4-yl)methanamine;N-[2-formyl-3-(methylamino)propyl]formamide (PubChem CID 156723274) has the molecular formula C26H42Cl2N4O3S and a molecular weight of 561.62 g/mol. Its IUPAC name is N-tert-butylsulfanyl-1-(4,5-dichloro-2-prop-2-enoxyphenyl)-1-(1-methylpiperidin-4-yl)methanamine;N-[2-formyl-3-(methylamino)propyl]formamide.
| Compound Name | N-tert-butylsulfanyl-1-(4,5-dichloro-2-prop-2-enoxyphenyl)-1-(1-methylpiperidin-4-yl)methanamine;N-[2-formyl-3-(methylamino)propyl]formamide |
|---|---|
| PubChem CID | 156723274 |
| Molecular Formula | C26H42Cl2N4O3S |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | N-tert-butylsulfanyl-1-(4,5-dichloro-2-prop-2-enoxyphenyl)-1-(1-methylpiperidin-4-yl)methanamine;N-[2-formyl-3-(methylamino)propyl]formamide |
| SMILES | C=CCOc1cc(Cl)c(Cl)cc1C(NSC(C)(C)C)C1CCN(C)CC1.CNCC(C=O)CNC=O |
| InChI | InChI=1S/C20H30Cl2N2OS.C6H12N2O2/c1-6-11-25-18-13-17(22)16(21)12-15(18)19(23-26-20(2,3)4)14-7-9-24(5)10-8-14;1-7-2-6(4-9)3-8-5-10/h6,12-14,19,23H,1,7-11H2,2-5H3;4-7H,2-3H2,1H3,(H,8,10) |
| InChIKey | RUUUDKVZHSEOAD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|