C15H21N3O3 — CID 156724431
ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]-1-methyl-2,4-dioxopyrimidine-5-carboxamide (PubChem CID 156724431) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]-1-methyl-2,4-dioxopyrimidine-5-carboxamide.
| Compound Name | ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]-1-methyl-2,4-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 156724431 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | ethane;N-[(2E)-2-ethenylpenta-2,4-dienyl]-1-methyl-2,4-dioxopyrimidine-5-carboxamide |
| SMILES | C=C/C=C(\C=C)CNC(=O)c1cn(C)c(=O)[nH]c1=O.CC |
| InChI | InChI=1S/C13H15N3O3.C2H6/c1-4-6-9(5-2)7-14-11(17)10-8-16(3)13(19)15-12(10)18;1-2/h4-6,8H,1-2,7H2,3H3,(H,14,17)(H,15,18,19);1-2H3/b9-6+; |
| InChIKey | JWSHGWLPGYZBNH-MLBSPLJJSA-N |
| XLogP | 1.13 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|