About 4-cyclopropyl-5,7-dimethyl-1-benzofuran
4-cyclopropyl-5,7-dimethyl-1-benzofuran (PubChem CID 156724618) has the molecular formula C13H14O
and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-cyclopropyl-5,7-dimethyl-1-benzofuran.
Molecular Properties
| Compound Name | 4-cyclopropyl-5,7-dimethyl-1-benzofuran |
| PubChem CID | 156724618 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 4-cyclopropyl-5,7-dimethyl-1-benzofuran |
| SMILES | Cc1cc(C)c2occc2c1C1CC1 |
| InChI | InChI=1S/C13H14O/c1-8-7-9(2)13-11(5-6-14-13)12(8)10-3-4-10/h5-7,10H,3-4H2,1-2H3 |
| InChIKey | KRBSNBSSKDVJAK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclopropyl-5,7-dimethyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-5,7-dimethyl-1-benzofuran?
The IUPAC name of 4-cyclopropyl-5,7-dimethyl-1-benzofuran (CID 156724618) is 4-cyclopropyl-5,7-dimethyl-1-benzofuran.
What is the SMILES notation for 4-cyclopropyl-5,7-dimethyl-1-benzofuran?
The canonical SMILES for 4-cyclopropyl-5,7-dimethyl-1-benzofuran is Cc1cc(C)c2occc2c1C1CC1.
What is the InChIKey of 4-cyclopropyl-5,7-dimethyl-1-benzofuran?
The InChIKey is KRBSNBSSKDVJAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O/c1-8-7-9(2)13-11(5-6-14-13)12(8)10-3-4-10/h5-7,10H,3-4H2,1-2H3.
What are the key properties of 4-cyclopropyl-5,7-dimethyl-1-benzofuran?
4-cyclopropyl-5,7-dimethyl-1-benzofuran has a molecular weight of 186.25 g/mol, XLogP of 3.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-5,7-dimethyl-1-benzofuran is sourced from PubChem (CID 156724618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).