About ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine
ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine (PubChem CID 156724854) has the molecular formula C10H21NS
and a molecular weight of 187.35 g/mol. Its IUPAC name is ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine.
Molecular Properties
| Compound Name | ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine |
| PubChem CID | 156724854 |
| Molecular Formula | C10H21NS |
| Molecular Weight | 187.35 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine |
| SMILES | C=C(C)/C=C(\SC)C(C)N.CC |
| InChI | InChI=1S/C8H15NS.C2H6/c1-6(2)5-8(10-4)7(3)9;1-2/h5,7H,1,9H2,2-4H3;1-2H3/b8-5-; |
| InChIKey | QCFANQSMSJFJIG-HGKIGUAWSA-N |
| XLogP | 3.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine?
The IUPAC name of ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine (CID 156724854) is ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine.
What is the SMILES notation for ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine?
The canonical SMILES for ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine is C=C(C)/C=C(\SC)C(C)N.CC.
What is the InChIKey of ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine?
The InChIKey is QCFANQSMSJFJIG-HGKIGUAWSA-N. The full InChI is InChI=1S/C8H15NS.C2H6/c1-6(2)5-8(10-4)7(3)9;1-2/h5,7H,1,9H2,2-4H3;1-2H3/b8-5-;.
What are the key properties of ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine?
ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine has a molecular weight of 187.35 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z)-5-methyl-3-methylsulfanylhexa-3,5-dien-2-amine is sourced from PubChem (CID 156724854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).