C28H34N4O3 — CID 156725406
5-[3-(aminomethyl)phenyl]-N-[(3Z,5Z)-3-formylhepta-1,3,5-trien-4-yl]-1-propan-2-ylindazole-3-carboxamide;methoxymethane (PubChem CID 156725406) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 5-[3-(aminomethyl)phenyl]-N-[(3Z,5Z)-3-formylhepta-1,3,5-trien-4-yl]-1-propan-2-ylindazole-3-carboxamide;methoxymethane.
| Compound Name | 5-[3-(aminomethyl)phenyl]-N-[(3Z,5Z)-3-formylhepta-1,3,5-trien-4-yl]-1-propan-2-ylindazole-3-carboxamide;methoxymethane |
|---|---|
| PubChem CID | 156725406 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 5-[3-(aminomethyl)phenyl]-N-[(3Z,5Z)-3-formylhepta-1,3,5-trien-4-yl]-1-propan-2-ylindazole-3-carboxamide;methoxymethane |
| SMILES | C=C/C(C=O)=C(\C=C/C)NC(=O)c1nn(C(C)C)c2ccc(-c3cccc(CN)c3)cc12.COC |
| InChI | InChI=1S/C26H28N4O2.C2H6O/c1-5-8-23(19(6-2)16-31)28-26(32)25-22-14-21(20-10-7-9-18(13-20)15-27)11-12-24(22)30(29-25)17(3)4;1-3-2/h5-14,16-17H,2,15,27H2,1,3-4H3,(H,28,32);1-2H3/b8-5-,23-19-; |
| InChIKey | TWQSBPZPCCKEOF-NKINCNPMSA-N |
| XLogP | 4.95 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|