About (2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine
(2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine (PubChem CID 156725768) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is (2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine |
| PubChem CID | 156725768 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine |
| SMILES | C=CCN/C(C)=C(F)/C=C\C |
| InChI | InChI=1S/C9H14FN/c1-4-6-9(10)8(3)11-7-5-2/h4-6,11H,2,7H2,1,3H3/b6-4-,9-8- |
| InChIKey | XNZVPZMFBWNQIK-KDAARUEYSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine?
The IUPAC name of (2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine (CID 156725768) is (2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine.
What is the SMILES notation for (2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine?
The canonical SMILES for (2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine is C=CCN/C(C)=C(F)/C=C\C.
What is the InChIKey of (2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine?
The InChIKey is XNZVPZMFBWNQIK-KDAARUEYSA-N. The full InChI is InChI=1S/C9H14FN/c1-4-6-9(10)8(3)11-7-5-2/h4-6,11H,2,7H2,1,3H3/b6-4-,9-8-.
What are the key properties of (2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine?
(2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine has a molecular weight of 155.22 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-3-fluoro-N-prop-2-enylhexa-2,4-dien-2-amine is sourced from PubChem (CID 156725768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).