C32H60N2 — CID 156726335
2,2,6,6-tetramethyl-4-[3,3,6,6-tetramethyl-2-methylidene-7-[(2,2,6,6-tetramethylpiperidin-4-yl)methyl]oct-7-enyl]piperidine (PubChem CID 156726335) has the molecular formula C32H60N2 and a molecular weight of 472.85 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-[3,3,6,6-tetramethyl-2-methylidene-7-[(2,2,6,6-tetramethylpiperidin-4-yl)methyl]oct-7-enyl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-[3,3,6,6-tetramethyl-2-methylidene-7-[(2,2,6,6-tetramethylpiperidin-4-yl)methyl]oct-7-enyl]piperidine |
|---|---|
| PubChem CID | 156726335 |
| Molecular Formula | C32H60N2 |
| Molecular Weight | 472.85 g/mol |
| Exact Mass | 472.48 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-[3,3,6,6-tetramethyl-2-methylidene-7-[(2,2,6,6-tetramethylpiperidin-4-yl)methyl]oct-7-enyl]piperidine |
| SMILES | C=C(CC1CC(C)(C)NC(C)(C)C1)C(C)(C)CCC(C)(C)C(=C)CC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C32H60N2/c1-23(17-25-19-29(7,8)33-30(9,10)20-25)27(3,4)15-16-28(5,6)24(2)18-26-21-31(11,12)34-32(13,14)22-26/h25-26,33-34H,1-2,15-22H2,3-14H3 |
| InChIKey | IBUQZSHVGAMVDZ-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.85 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|