C18H29BN4O3 — CID 156726594
N-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[5,6-dihydropyrrolo[1,2-b]pyrazole-4,3'-pyrrolidine]-1'-carboxamide (PubChem CID 156726594) has the molecular formula C18H29BN4O3 and a molecular weight of 360.27 g/mol. Its IUPAC name is N-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[5,6-dihydropyrrolo[1,2-b]pyrazole-4,3'-pyrrolidine]-1'-carboxamide.
| Compound Name | N-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[5,6-dihydropyrrolo[1,2-b]pyrazole-4,3'-pyrrolidine]-1'-carboxamide |
|---|---|
| PubChem CID | 156726594 |
| Molecular Formula | C18H29BN4O3 |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | N-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)spiro[5,6-dihydropyrrolo[1,2-b]pyrazole-4,3'-pyrrolidine]-1'-carboxamide |
| SMILES | CCNC(=O)N1CCC2(CCn3nc(B4OC(C)(C)C(C)(C)O4)cc32)C1 |
| InChI | InChI=1S/C18H29BN4O3/c1-6-20-15(24)22-9-7-18(12-22)8-10-23-13(18)11-14(21-23)19-25-16(2,3)17(4,5)26-19/h11H,6-10,12H2,1-5H3,(H,20,24) |
| InChIKey | QUUWGIJLDZJWML-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|