C17H28FN — CID 156726640
(2Z,4E)-3-but-1-en-2-yl-2,4-diethyl-7-fluoro-6-methylideneocta-2,4-dien-1-amine (PubChem CID 156726640) has the molecular formula C17H28FN and a molecular weight of 265.42 g/mol. Its IUPAC name is (2Z,4E)-3-but-1-en-2-yl-2,4-diethyl-7-fluoro-6-methylideneocta-2,4-dien-1-amine.
| Compound Name | (2Z,4E)-3-but-1-en-2-yl-2,4-diethyl-7-fluoro-6-methylideneocta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 156726640 |
| Molecular Formula | C17H28FN |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | (2Z,4E)-3-but-1-en-2-yl-2,4-diethyl-7-fluoro-6-methylideneocta-2,4-dien-1-amine |
| SMILES | C=C(CC)C(=C(\CC)CN)/C(=C/C(=C)C(C)F)CC |
| InChI | InChI=1S/C17H28FN/c1-7-12(4)17(16(9-3)11-19)15(8-2)10-13(5)14(6)18/h10,14H,4-5,7-9,11,19H2,1-3,6H3/b15-10+,17-16- |
| InChIKey | ZBUDZYBMDOAPJI-QRMQZIJDSA-N |
| XLogP | 4.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|