About 3,5-dibromo-1H-pyrazole;ethane
3,5-dibromo-1H-pyrazole;ethane (PubChem CID 156727917) has the molecular formula C5H8Br2N2
and a molecular weight of 255.94 g/mol. Its IUPAC name is 3,5-dibromo-1H-pyrazole;ethane.
Molecular Properties
| Compound Name | 3,5-dibromo-1H-pyrazole;ethane |
| PubChem CID | 156727917 |
| Molecular Formula | C5H8Br2N2 |
| Molecular Weight | 255.94 g/mol |
| Exact Mass | 253.91 |
| IUPAC Name | 3,5-dibromo-1H-pyrazole;ethane |
| SMILES | Brc1cc(Br)[nH]n1.CC |
| InChI | InChI=1S/C3H2Br2N2.C2H6/c4-2-1-3(5)7-6-2;1-2/h1H,(H,6,7);1-2H3 |
| InChIKey | YTXPDUBRKLOLGE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.94 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dibromo-1H-pyrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dibromo-1H-pyrazole;ethane?
The IUPAC name of 3,5-dibromo-1H-pyrazole;ethane (CID 156727917) is 3,5-dibromo-1H-pyrazole;ethane.
What is the SMILES notation for 3,5-dibromo-1H-pyrazole;ethane?
The canonical SMILES for 3,5-dibromo-1H-pyrazole;ethane is Brc1cc(Br)[nH]n1.CC.
What is the InChIKey of 3,5-dibromo-1H-pyrazole;ethane?
The InChIKey is YTXPDUBRKLOLGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2Br2N2.C2H6/c4-2-1-3(5)7-6-2;1-2/h1H,(H,6,7);1-2H3.
What are the key properties of 3,5-dibromo-1H-pyrazole;ethane?
3,5-dibromo-1H-pyrazole;ethane has a molecular weight of 255.94 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dibromo-1H-pyrazole;ethane is sourced from PubChem (CID 156727917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).