C25H34O2 — CID 156727950
2-methyl-3-[(E)-3,5,5,7,8-pentamethylnon-2-enyl]naphthalene-1,4-dione (PubChem CID 156727950) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is 2-methyl-3-[(E)-3,5,5,7,8-pentamethylnon-2-enyl]naphthalene-1,4-dione.
| Compound Name | 2-methyl-3-[(E)-3,5,5,7,8-pentamethylnon-2-enyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 156727950 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 2-methyl-3-[(E)-3,5,5,7,8-pentamethylnon-2-enyl]naphthalene-1,4-dione |
| SMILES | CC1=C(C/C=C(\C)CC(C)(C)CC(C)C(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H34O2/c1-16(2)18(4)15-25(6,7)14-17(3)12-13-20-19(5)23(26)21-10-8-9-11-22(21)24(20)27/h8-12,16,18H,13-15H2,1-7H3/b17-12+ |
| InChIKey | UOKUMRPZCGMJLV-SFQUDFHCSA-N |
| XLogP | 6.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|