C25H42O3 — CID 156727958
2-(3-hydroxy-3,4,4,7,7,10-hexamethylundecyl)-3,5-dimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 156727958) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is 2-(3-hydroxy-3,4,4,7,7,10-hexamethylundecyl)-3,5-dimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(3-hydroxy-3,4,4,7,7,10-hexamethylundecyl)-3,5-dimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 156727958 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 2-(3-hydroxy-3,4,4,7,7,10-hexamethylundecyl)-3,5-dimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(CCC(C)(O)C(C)(C)CCC(C)(C)CCC(C)C)=C(C)C1=O |
| InChI | InChI=1S/C25H42O3/c1-17(2)10-12-23(5,6)14-15-24(7,8)25(9,28)13-11-20-19(4)22(27)18(3)16-21(20)26/h16-17,28H,10-15H2,1-9H3 |
| InChIKey | OCQZEQKLEUCYPH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|