C29H50O2 — CID 156727961
(2S)-2-[(5S)-2,2,5,7,7,10-hexamethylundecyl]-2,7,8-trimethyl-3,4-dihydrochromen-6-ol (PubChem CID 156727961) has the molecular formula C29H50O2 and a molecular weight of 430.72 g/mol. Its IUPAC name is (2S)-2-[(5S)-2,2,5,7,7,10-hexamethylundecyl]-2,7,8-trimethyl-3,4-dihydrochromen-6-ol.
| Compound Name | (2S)-2-[(5S)-2,2,5,7,7,10-hexamethylundecyl]-2,7,8-trimethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 156727961 |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | (2S)-2-[(5S)-2,2,5,7,7,10-hexamethylundecyl]-2,7,8-trimethyl-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(O)cc2c(c1C)O[C@](C)(CC(C)(C)CC[C@H](C)CC(C)(C)CCC(C)C)CC2 |
| InChI | InChI=1S/C29H50O2/c1-20(2)11-14-27(6,7)18-21(3)12-15-28(8,9)19-29(10)16-13-24-17-25(30)22(4)23(5)26(24)31-29/h17,20-21,30H,11-16,18-19H2,1-10H3/t21-,29-/m0/s1 |
| InChIKey | SMDDOGXRNPUVRO-LGGPFLRQSA-N |
| XLogP | 8.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |