C13H21Rb — CID 156728674
ethane;1,2,3,4,5-pentamethylbenzene-6-ide;rubidium(1+) (PubChem CID 156728674) has the molecular formula C13H21Rb and a molecular weight of 262.78 g/mol. Its IUPAC name is ethane;1,2,3,4,5-pentamethylbenzene-6-ide;rubidium(1+).
| Compound Name | ethane;1,2,3,4,5-pentamethylbenzene-6-ide;rubidium(1+) |
|---|---|
| PubChem CID | 156728674 |
| Molecular Formula | C13H21Rb |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | ethane;1,2,3,4,5-pentamethylbenzene-6-ide;rubidium(1+) |
| SMILES | CC.Cc1[c-]c(C)c(C)c(C)c1C.[Rb+] |
| InChI | InChI=1S/C11H15.C2H6.Rb/c1-7-6-8(2)10(4)11(5)9(7)3;1-2;/h1-5H3;1-2H3;/q-1;;+1 |
| InChIKey | CKTWHYIFNFQQPZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|