C21H30F3KN2O2 — CID 156728692
potassium;3-(difluoromethyl)-5-[2-(dimethylamino)ethyl]-1-(4-methyl-1-oxopentan-2-yl)pyridin-2-one;2-fluoro-3-methylbuta-1,3-diene (PubChem CID 156728692) has the molecular formula C21H30F3KN2O2 and a molecular weight of 438.58 g/mol. Its IUPAC name is potassium;3-(difluoromethyl)-5-[2-(dimethylamino)ethyl]-1-(4-methyl-1-oxopentan-2-yl)pyridin-2-one;2-fluoro-3-methylbuta-1,3-diene.
| Compound Name | potassium;3-(difluoromethyl)-5-[2-(dimethylamino)ethyl]-1-(4-methyl-1-oxopentan-2-yl)pyridin-2-one;2-fluoro-3-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 156728692 |
| Molecular Formula | C21H30F3KN2O2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | potassium;3-(difluoromethyl)-5-[2-(dimethylamino)ethyl]-1-(4-methyl-1-oxopentan-2-yl)pyridin-2-one;2-fluoro-3-methylbuta-1,3-diene |
| SMILES | C=C(C)C(=C)F.CC(C)CC([C-]=O)n1cc(CCN(C)C)cc(C(F)F)c1=O.[K+] |
| InChI | InChI=1S/C16H23F2N2O2.C5H7F.K/c1-11(2)7-13(10-21)20-9-12(5-6-19(3)4)8-14(15(17)18)16(20)22;1-4(2)5(3)6;/h8-9,11,13,15H,5-7H2,1-4H3;1,3H2,2H3;/q-1;;+1 |
| InChIKey | FZWLTYNCCVYULC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|