C16H20F4N4 — CID 156729966
5-[(Z)-1-amino-3-methyl-2-(2,2,2-trifluoroethyliminomethyl)but-1-enyl]-N-cyclopropyl-6-fluoropyridin-2-amine (PubChem CID 156729966) has the molecular formula C16H20F4N4 and a molecular weight of 344.36 g/mol. Its IUPAC name is 5-[(Z)-1-amino-3-methyl-2-(2,2,2-trifluoroethyliminomethyl)but-1-enyl]-N-cyclopropyl-6-fluoropyridin-2-amine.
| Compound Name | 5-[(Z)-1-amino-3-methyl-2-(2,2,2-trifluoroethyliminomethyl)but-1-enyl]-N-cyclopropyl-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 156729966 |
| Molecular Formula | C16H20F4N4 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 5-[(Z)-1-amino-3-methyl-2-(2,2,2-trifluoroethyliminomethyl)but-1-enyl]-N-cyclopropyl-6-fluoropyridin-2-amine |
| SMILES | CC(C)C(/C=N/CC(F)(F)F)=C(/N)c1ccc(NC2CC2)nc1F |
| InChI | InChI=1S/C16H20F4N4/c1-9(2)12(7-22-8-16(18,19)20)14(21)11-5-6-13(24-15(11)17)23-10-3-4-10/h5-7,9-10H,3-4,8,21H2,1-2H3,(H,23,24)/b14-12+,22-7+ |
| InChIKey | YUALCGRHSUCOGU-LPNLQVQXSA-N |
| XLogP | 3.75 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|