C12H17N5 — CID 156730122
(E,2Z)-N'-methyl-2-[1-(methylideneamino)ethylidene]-3-(1H-pyrazol-5-yl)pent-3-enimidamide (PubChem CID 156730122) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is (E,2Z)-N'-methyl-2-[1-(methylideneamino)ethylidene]-3-(1H-pyrazol-5-yl)pent-3-enimidamide.
| Compound Name | (E,2Z)-N'-methyl-2-[1-(methylideneamino)ethylidene]-3-(1H-pyrazol-5-yl)pent-3-enimidamide |
|---|---|
| PubChem CID | 156730122 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | (E,2Z)-N'-methyl-2-[1-(methylideneamino)ethylidene]-3-(1H-pyrazol-5-yl)pent-3-enimidamide |
| SMILES | C=N/C(C)=C(C(\N)=N\C)/C(=C\C)c1ccn[nH]1 |
| InChI | InChI=1S/C12H17N5/c1-5-9(10-6-7-16-17-10)11(8(2)14-3)12(13)15-4/h5-7H,3H2,1-2,4H3,(H2,13,15)(H,16,17)/b9-5-,11-8- |
| InChIKey | RWDHIWPNPGAXHF-DQIWSBTHSA-N |
| XLogP | 1.77 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|