C28H30Cl2N8O2 — CID 156730492
4-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]-N-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1,3,5-triazin-2-amine (PubChem CID 156730492) has the molecular formula C28H30Cl2N8O2 and a molecular weight of 581.51 g/mol. Its IUPAC name is 4-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]-N-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]-N-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 156730492 |
| Molecular Formula | C28H30Cl2N8O2 |
| Molecular Weight | 581.51 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 4-[2-(2,6-dichloro-3,5-dimethoxyanilino)-3-pyridinyl]-N-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]-1,3,5-triazin-2-amine |
| SMILES | COc1cc(OC)c(Cl)c(Nc2ncccc2-c2ncnc(Nc3ccc(N4C[C@@H](C)N[C@@H](C)C4)cc3)n2)c1Cl |
| InChI | InChI=1S/C28H30Cl2N8O2/c1-16-13-38(14-17(2)34-16)19-9-7-18(8-10-19)35-28-33-15-32-27(37-28)20-6-5-11-31-26(20)36-25-23(29)21(39-3)12-22(40-4)24(25)30/h5-12,15-17,34H,13-14H2,1-4H3,(H,31,36)(H,32,33,35,37)/t16-,17+ |
| InChIKey | OLFFNBYRJZHMRQ-CALCHBBNSA-N |
| XLogP | 5.93 |
| TPSA | 109.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|