C17H26FNO — CID 156730810
N-[(5Z)-3-fluoro-3-methyl-4,7-dimethylidenenona-5,8-dienyl]-N,3-dimethyloxetan-3-amine (PubChem CID 156730810) has the molecular formula C17H26FNO and a molecular weight of 279.40 g/mol. Its IUPAC name is N-[(5Z)-3-fluoro-3-methyl-4,7-dimethylidenenona-5,8-dienyl]-N,3-dimethyloxetan-3-amine.
| Compound Name | N-[(5Z)-3-fluoro-3-methyl-4,7-dimethylidenenona-5,8-dienyl]-N,3-dimethyloxetan-3-amine |
|---|---|
| PubChem CID | 156730810 |
| Molecular Formula | C17H26FNO |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N-[(5Z)-3-fluoro-3-methyl-4,7-dimethylidenenona-5,8-dienyl]-N,3-dimethyloxetan-3-amine |
| SMILES | C=CC(=C)/C=C\C(=C)C(C)(F)CCN(C)C1(C)COC1 |
| InChI | InChI=1S/C17H26FNO/c1-7-14(2)8-9-15(3)17(5,18)10-11-19(6)16(4)12-20-13-16/h7-9H,1-3,10-13H2,4-6H3/b9-8- |
| InChIKey | CBIDRVWEXIHCJM-HJWRWDBZSA-N |
| XLogP | 3.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|