C24H20N4O6 — CID 156730923
4-[4-[(E)-[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid (PubChem CID 156730923) has the molecular formula C24H20N4O6 and a molecular weight of 460.45 g/mol. Its IUPAC name is 4-[4-[(E)-[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid.
| Compound Name | 4-[4-[(E)-[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 156730923 |
| Molecular Formula | C24H20N4O6 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 4-[4-[(E)-[5-(4,5-dimethyl-2-nitrophenyl)furan-2-yl]iminomethyl]-5-methyl-3-oxo-1H-pyrazol-2-yl]benzoic acid |
| SMILES | Cc1cc(-c2ccc(/N=C/c3c(C)[nH]n(-c4ccc(C(=O)O)cc4)c3=O)o2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C24H20N4O6/c1-13-10-18(20(28(32)33)11-14(13)2)21-8-9-22(34-21)25-12-19-15(3)26-27(23(19)29)17-6-4-16(5-7-17)24(30)31/h4-12,26H,1-3H3,(H,30,31)/b25-12+ |
| InChIKey | JHINFSMLGXPQFH-BRJLIKDPSA-N |
| XLogP | 4.71 |
| TPSA | 143.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|