C17H25N3O — CID 156731802
1-azabicyclo[2.2.1]heptan-3-yl 4,5-bis(ethenyl)-N-methyl-3,6-dihydro-2H-pyridine-1-carboximidate (PubChem CID 156731802) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 1-azabicyclo[2.2.1]heptan-3-yl 4,5-bis(ethenyl)-N-methyl-3,6-dihydro-2H-pyridine-1-carboximidate.
| Compound Name | 1-azabicyclo[2.2.1]heptan-3-yl 4,5-bis(ethenyl)-N-methyl-3,6-dihydro-2H-pyridine-1-carboximidate |
|---|---|
| PubChem CID | 156731802 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 1-azabicyclo[2.2.1]heptan-3-yl 4,5-bis(ethenyl)-N-methyl-3,6-dihydro-2H-pyridine-1-carboximidate |
| SMILES | C=CC1=C(C=C)CN(/C(=N\C)OC2CN3CCC2C3)CC1 |
| InChI | InChI=1S/C17H25N3O/c1-4-13-7-9-20(11-14(13)5-2)17(18-3)21-16-12-19-8-6-15(16)10-19/h4-5,15-16H,1-2,6-12H2,3H3/b18-17+ |
| InChIKey | RBTSKGHGEXXLEZ-ISLYRVAYSA-N |
| XLogP | 2.07 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|