About ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate
ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate (PubChem CID 156732111) has the molecular formula C14H21F2NO4
and a molecular weight of 305.32 g/mol. Its IUPAC name is ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate |
| PubChem CID | 156732111 |
| Molecular Formula | C14H21F2NO4 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C[C@H](NC(=O)OC(C)(C)C)C(F)(F)CC1 |
| InChI | InChI=1S/C14H21F2NO4/c1-5-20-11(18)9-6-7-14(15,16)10(8-9)17-12(19)21-13(2,3)4/h8,10H,5-7H2,1-4H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | OQNCDEOYYSOBBP-JTQLQIEISA-N |
| XLogP | 2.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate?
The IUPAC name of ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate (CID 156732111) is ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate.
What is the SMILES notation for ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate?
The canonical SMILES for ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate is CCOC(=O)C1=C[C@H](NC(=O)OC(C)(C)C)C(F)(F)CC1.
What is the InChIKey of ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate?
The InChIKey is OQNCDEOYYSOBBP-JTQLQIEISA-N. The full InChI is InChI=1S/C14H21F2NO4/c1-5-20-11(18)9-6-7-14(15,16)10(8-9)17-12(19)21-13(2,3)4/h8,10H,5-7H2,1-4H3,(H,17,19)/t10-/m0/s1.
What are the key properties of ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate?
ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate has a molecular weight of 305.32 g/mol, XLogP of 2.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3S)-4,4-difluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexene-1-carboxylate is sourced from PubChem (CID 156732111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).