C20H29FN4 — CID 156732509
4-[(3S)-3-aminopiperidin-1-yl]-6-(2-fluoro-6-methylcyclohex-3-en-1-yl)-5,6-dihydro-1H-indol-2-amine (PubChem CID 156732509) has the molecular formula C20H29FN4 and a molecular weight of 344.48 g/mol. Its IUPAC name is 4-[(3S)-3-aminopiperidin-1-yl]-6-(2-fluoro-6-methylcyclohex-3-en-1-yl)-5,6-dihydro-1H-indol-2-amine.
| Compound Name | 4-[(3S)-3-aminopiperidin-1-yl]-6-(2-fluoro-6-methylcyclohex-3-en-1-yl)-5,6-dihydro-1H-indol-2-amine |
|---|---|
| PubChem CID | 156732509 |
| Molecular Formula | C20H29FN4 |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 4-[(3S)-3-aminopiperidin-1-yl]-6-(2-fluoro-6-methylcyclohex-3-en-1-yl)-5,6-dihydro-1H-indol-2-amine |
| SMILES | CC1CC=CC(F)C1C1C=c2[nH]c(N)cc2=C(N2CCC[C@H](N)C2)C1 |
| InChI | InChI=1S/C20H29FN4/c1-12-4-2-6-16(21)20(12)13-8-17-15(10-19(23)24-17)18(9-13)25-7-3-5-14(22)11-25/h2,6,8,10,12-14,16,20,24H,3-5,7,9,11,22-23H2,1H3/t12?,13?,14-,16?,20?/m0/s1 |
| InChIKey | XRJFZQPKCHUQKI-CEIAKLMWSA-N |
| XLogP | 1.48 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|