C15H13F7N2O2S — CID 156732761
1-(2-ethylsulfinylphenyl)-3-(2,2,3,3,4,4,4-heptafluorobutoxy)pyrazole (PubChem CID 156732761) has the molecular formula C15H13F7N2O2S and a molecular weight of 418.33 g/mol. Its IUPAC name is 1-(2-ethylsulfinylphenyl)-3-(2,2,3,3,4,4,4-heptafluorobutoxy)pyrazole.
| Compound Name | 1-(2-ethylsulfinylphenyl)-3-(2,2,3,3,4,4,4-heptafluorobutoxy)pyrazole |
|---|---|
| PubChem CID | 156732761 |
| Molecular Formula | C15H13F7N2O2S |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 1-(2-ethylsulfinylphenyl)-3-(2,2,3,3,4,4,4-heptafluorobutoxy)pyrazole |
| SMILES | CCS(=O)c1ccccc1-n1ccc(OCC(F)(F)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C15H13F7N2O2S/c1-2-27(25)11-6-4-3-5-10(11)24-8-7-12(23-24)26-9-13(16,17)14(18,19)15(20,21)22/h3-8H,2,9H2,1H3 |
| InChIKey | ZURCBTIUJWPWIV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|