About trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane
trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane (PubChem CID 156732836) has the molecular formula C9H18O2Si
and a molecular weight of 186.33 g/mol. Its IUPAC name is trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane.
Molecular Properties
| Compound Name | trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane |
| PubChem CID | 156732836 |
| Molecular Formula | C9H18O2Si |
| Molecular Weight | 186.33 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane |
| SMILES | CC1=C(O[Si](C)(C)C)CCOC1 |
| InChI | InChI=1S/C9H18O2Si/c1-8-7-10-6-5-9(8)11-12(2,3)4/h5-7H2,1-4H3 |
| InChIKey | PUWWJGQQZGQABR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane?
The IUPAC name of trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane (CID 156732836) is trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane.
What is the SMILES notation for trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane?
The canonical SMILES for trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane is CC1=C(O[Si](C)(C)C)CCOC1.
What is the InChIKey of trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane?
The InChIKey is PUWWJGQQZGQABR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2Si/c1-8-7-10-6-5-9(8)11-12(2,3)4/h5-7H2,1-4H3.
What are the key properties of trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane?
trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane has a molecular weight of 186.33 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(5-methyl-3,6-dihydro-2H-pyran-4-yl)oxy]silane is sourced from PubChem (CID 156732836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).