C14H16F3NO2 — CID 156732855
3-(3,6-dihydro-2H-pyran-4-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyaniline (PubChem CID 156732855) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is 3-(3,6-dihydro-2H-pyran-4-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyaniline.
| Compound Name | 3-(3,6-dihydro-2H-pyran-4-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyaniline |
|---|---|
| PubChem CID | 156732855 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-(3,6-dihydro-2H-pyran-4-yl)-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyaniline |
| SMILES | C[C@H](Oc1c(N)cccc1C1=CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2/c1-9(14(15,16)17)20-13-11(3-2-4-12(13)18)10-5-7-19-8-6-10/h2-5,9H,6-8,18H2,1H3/t9-/m0/s1 |
| InChIKey | BZRWGTCSYOLZBN-VIFPVBQESA-N |
| XLogP | 3.40 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|