C38H46ClN3O5 — CID 156733035
ethyl (2S)-3-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 156733035) has the molecular formula C38H46ClN3O5 and a molecular weight of 660.26 g/mol. Its IUPAC name is ethyl (2S)-3-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | ethyl (2S)-3-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 156733035 |
| Molecular Formula | C38H46ClN3O5 |
| Molecular Weight | 660.26 g/mol |
| Exact Mass | 659.31 |
| IUPAC Name | ethyl (2S)-3-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(OCCCN2CCC(=C3c4ccc(Cl)cc4CCc4cccnc43)CC2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H46ClN3O5/c1-5-45-36(43)33(41-37(44)47-38(2,3)4)24-26-9-14-31(15-10-26)46-23-7-20-42-21-17-27(18-22-42)34-32-16-13-30(39)25-29(32)12-11-28-8-6-19-40-35(28)34/h6,8-10,13-16,19,25,33H,5,7,11-12,17-18,20-24H2,1-4H3,(H,41,44)/t33-/m0/s1 |
| InChIKey | VLGQHNYKKMITRE-XIFFEERXSA-N |
| XLogP | 7.20 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.26 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|