C25H43N3O3 — CID 156733130
ethane;[(E)-[(2E,5Z)-3-(2-methylpropylcarbamoyl)hepta-2,5-dienylidene]amino]methyl carbamate;5-propylcyclohexa-1,3-diene (PubChem CID 156733130) has the molecular formula C25H43N3O3 and a molecular weight of 433.64 g/mol. Its IUPAC name is ethane;[(E)-[(2E,5Z)-3-(2-methylpropylcarbamoyl)hepta-2,5-dienylidene]amino]methyl carbamate;5-propylcyclohexa-1,3-diene.
| Compound Name | ethane;[(E)-[(2E,5Z)-3-(2-methylpropylcarbamoyl)hepta-2,5-dienylidene]amino]methyl carbamate;5-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 156733130 |
| Molecular Formula | C25H43N3O3 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.33 |
| IUPAC Name | ethane;[(E)-[(2E,5Z)-3-(2-methylpropylcarbamoyl)hepta-2,5-dienylidene]amino]methyl carbamate;5-propylcyclohexa-1,3-diene |
| SMILES | C/C=C\C/C(=C\C=N\COC(N)=O)C(=O)NCC(C)C.CC.CCCC1C=CC=CC1 |
| InChI | InChI=1S/C14H23N3O3.C9H14.C2H6/c1-4-5-6-12(13(18)17-9-11(2)3)7-8-16-10-20-14(15)19;1-2-6-9-7-4-3-5-8-9;1-2/h4-5,7-8,11H,6,9-10H2,1-3H3,(H2,15,19)(H,17,18);3-5,7,9H,2,6,8H2,1H3;1-2H3/b5-4-,12-7+,16-8+;; |
| InChIKey | PKPSZTDNTMZCQY-UYEWRJBCSA-N |
| XLogP | 5.72 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|