C16H13F9 — CID 156733222
ethane;1,2,3,4,5-pentafluoro-6-[(2Z,4E,6Z)-2,3,5,6-tetrafluoroocta-2,4,6-trien-4-yl]benzene (PubChem CID 156733222) has the molecular formula C16H13F9 and a molecular weight of 376.26 g/mol. Its IUPAC name is ethane;1,2,3,4,5-pentafluoro-6-[(2Z,4E,6Z)-2,3,5,6-tetrafluoroocta-2,4,6-trien-4-yl]benzene.
| Compound Name | ethane;1,2,3,4,5-pentafluoro-6-[(2Z,4E,6Z)-2,3,5,6-tetrafluoroocta-2,4,6-trien-4-yl]benzene |
|---|---|
| PubChem CID | 156733222 |
| Molecular Formula | C16H13F9 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | ethane;1,2,3,4,5-pentafluoro-6-[(2Z,4E,6Z)-2,3,5,6-tetrafluoroocta-2,4,6-trien-4-yl]benzene |
| SMILES | C/C=C(F)/C(F)=C(C(\F)=C(/C)F)/c1c(F)c(F)c(F)c(F)c1F.CC |
| InChI | InChI=1S/C14H7F9.C2H6/c1-3-5(16)9(18)6(8(17)4(2)15)7-10(19)12(21)14(23)13(22)11(7)20;1-2/h3H,1-2H3;1-2H3/b5-3-,8-4-,9-6+; |
| InChIKey | QZRPTWVBPDAXHM-ASNDAQBLSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|