About 5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole
5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole (PubChem CID 156734114) has the molecular formula C22H17F2N3
and a molecular weight of 361.40 g/mol. Its IUPAC name is 5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole.
Molecular Properties
| Compound Name | 5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole |
| PubChem CID | 156734114 |
| Molecular Formula | C22H17F2N3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole |
| SMILES | Fc1cc(F)cc(CCc2ccc3n[nH]c(/C=C/c4ccccn4)c3c2)c1 |
| InChI | InChI=1S/C22H17F2N3/c23-17-11-16(12-18(24)14-17)5-4-15-6-8-21-20(13-15)22(27-26-21)9-7-19-3-1-2-10-25-19/h1-3,6-14H,4-5H2,(H,26,27)/b9-7+ |
| InChIKey | QTSGFRRREQFWGK-VQHVLOKHSA-N |
| XLogP | 5.19 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole?
The IUPAC name of 5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole (CID 156734114) is 5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole.
What is the SMILES notation for 5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole?
The canonical SMILES for 5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole is Fc1cc(F)cc(CCc2ccc3n[nH]c(/C=C/c4ccccn4)c3c2)c1.
What is the InChIKey of 5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole?
The InChIKey is QTSGFRRREQFWGK-VQHVLOKHSA-N. The full InChI is InChI=1S/C22H17F2N3/c23-17-11-16(12-18(24)14-17)5-4-15-6-8-21-20(13-15)22(27-26-21)9-7-19-3-1-2-10-25-19/h1-3,6-14H,4-5H2,(H,26,27)/b9-7+.
What are the key properties of 5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole?
5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole has a molecular weight of 361.40 g/mol, XLogP of 5.19, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(3,5-difluorophenyl)ethyl]-3-[(E)-2-pyridin-2-ylethenyl]-2H-indazole is sourced from PubChem (CID 156734114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).