C20H13F2N3O — CID 156734147
5-(3,5-difluorophenoxy)-3-[(E)-2-pyridin-2-ylethenyl]-1H-indazole (PubChem CID 156734147) has the molecular formula C20H13F2N3O and a molecular weight of 349.34 g/mol. Its IUPAC name is 5-(3,5-difluorophenoxy)-3-[(E)-2-pyridin-2-ylethenyl]-1H-indazole.
| Compound Name | 5-(3,5-difluorophenoxy)-3-[(E)-2-pyridin-2-ylethenyl]-1H-indazole |
|---|---|
| PubChem CID | 156734147 |
| Molecular Formula | C20H13F2N3O |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 5-(3,5-difluorophenoxy)-3-[(E)-2-pyridin-2-ylethenyl]-1H-indazole |
| SMILES | Fc1cc(F)cc(Oc2ccc3[nH]nc(/C=C/c4ccccn4)c3c2)c1 |
| InChI | InChI=1S/C20H13F2N3O/c21-13-9-14(22)11-17(10-13)26-16-5-7-20-18(12-16)19(24-25-20)6-4-15-3-1-2-8-23-15/h1-12H,(H,24,25)/b6-4+ |
| InChIKey | RHGGEGBXSUZHQZ-GQCTYLIASA-N |
| XLogP | 5.20 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |