C22H31F2N5OS — CID 156735147
(Z)-N-[(3,5-difluoro-2-pyridinyl)methyl]-3-[1-[4-(3-methylpiperidin-1-yl)piperidin-1-yl]ethylideneamino]-2-sulfanylprop-2-enamide (PubChem CID 156735147) has the molecular formula C22H31F2N5OS and a molecular weight of 451.59 g/mol. Its IUPAC name is (Z)-N-[(3,5-difluoro-2-pyridinyl)methyl]-3-[1-[4-(3-methylpiperidin-1-yl)piperidin-1-yl]ethylideneamino]-2-sulfanylprop-2-enamide.
| Compound Name | (Z)-N-[(3,5-difluoro-2-pyridinyl)methyl]-3-[1-[4-(3-methylpiperidin-1-yl)piperidin-1-yl]ethylideneamino]-2-sulfanylprop-2-enamide |
|---|---|
| PubChem CID | 156735147 |
| Molecular Formula | C22H31F2N5OS |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | (Z)-N-[(3,5-difluoro-2-pyridinyl)methyl]-3-[1-[4-(3-methylpiperidin-1-yl)piperidin-1-yl]ethylideneamino]-2-sulfanylprop-2-enamide |
| SMILES | C/C(=N\C=C(/S)C(=O)NCc1ncc(F)cc1F)N1CCC(N2CCCC(C)C2)CC1 |
| InChI | InChI=1S/C22H31F2N5OS/c1-15-4-3-7-29(14-15)18-5-8-28(9-6-18)16(2)25-13-21(31)22(30)27-12-20-19(24)10-17(23)11-26-20/h10-11,13,15,18,31H,3-9,12,14H2,1-2H3,(H,27,30)/b21-13-,25-16+ |
| InChIKey | VVAIDIUXKRMOEP-LGUYEZQYSA-N |
| XLogP | 3.36 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|