About N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine
N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine (PubChem CID 156735850) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine.
Molecular Properties
| Compound Name | N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine |
| PubChem CID | 156735850 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine |
| SMILES | C=N/C(C)=C\C(=C)C(C)(C)C |
| InChI | InChI=1S/C10H17N/c1-8(10(3,4)5)7-9(2)11-6/h7H,1,6H2,2-5H3/b9-7- |
| InChIKey | AFTUWOLQXBTTHP-CLFYSBASSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine?
The IUPAC name of N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine (CID 156735850) is N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine.
What is the SMILES notation for N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine?
The canonical SMILES for N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine is C=N/C(C)=C\C(=C)C(C)(C)C.
What is the InChIKey of N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine?
The InChIKey is AFTUWOLQXBTTHP-CLFYSBASSA-N. The full InChI is InChI=1S/C10H17N/c1-8(10(3,4)5)7-9(2)11-6/h7H,1,6H2,2-5H3/b9-7-.
What are the key properties of N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine?
N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine has a molecular weight of 151.25 g/mol, XLogP of 3.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-5,5-dimethyl-4-methylidenehex-2-en-2-yl]methanimine is sourced from PubChem (CID 156735850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).