C19H19ClF3N3O3 — CID 156736239
3-[4-[4-chloro-2-(trifluoromethyl)phenoxy]-2-ethylpiperidin-1-yl]-2-nitropyridine (PubChem CID 156736239) has the molecular formula C19H19ClF3N3O3 and a molecular weight of 429.83 g/mol. Its IUPAC name is 3-[4-[4-chloro-2-(trifluoromethyl)phenoxy]-2-ethylpiperidin-1-yl]-2-nitropyridine.
| Compound Name | 3-[4-[4-chloro-2-(trifluoromethyl)phenoxy]-2-ethylpiperidin-1-yl]-2-nitropyridine |
|---|---|
| PubChem CID | 156736239 |
| Molecular Formula | C19H19ClF3N3O3 |
| Molecular Weight | 429.83 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 3-[4-[4-chloro-2-(trifluoromethyl)phenoxy]-2-ethylpiperidin-1-yl]-2-nitropyridine |
| SMILES | CCC1CC(Oc2ccc(Cl)cc2C(F)(F)F)CCN1c1cccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19ClF3N3O3/c1-2-13-11-14(29-17-6-5-12(20)10-15(17)19(21,22)23)7-9-25(13)16-4-3-8-24-18(16)26(27)28/h3-6,8,10,13-14H,2,7,9,11H2,1H3 |
| InChIKey | PVANEQDJUOVYGU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.83 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|