About 6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide
6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide (PubChem CID 156736532) has the molecular formula C6H11NOS
and a molecular weight of 145.23 g/mol. Its IUPAC name is 6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide.
Molecular Properties
| Compound Name | 6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide |
| PubChem CID | 156736532 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide |
| SMILES | CN1C2CC1CS(=O)C2 |
| InChI | InChI=1S/C6H11NOS/c1-7-5-2-6(7)4-9(8)3-5/h5-6H,2-4H2,1H3 |
| InChIKey | SFAKJGJFWWEPOG-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide?
The IUPAC name of 6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide (CID 156736532) is 6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide.
What is the SMILES notation for 6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide?
The canonical SMILES for 6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide is CN1C2CC1CS(=O)C2.
What is the InChIKey of 6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide?
The InChIKey is SFAKJGJFWWEPOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NOS/c1-7-5-2-6(7)4-9(8)3-5/h5-6H,2-4H2,1H3.
What are the key properties of 6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide?
6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide has a molecular weight of 145.23 g/mol, XLogP of -0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3λ4-thia-6-azabicyclo[3.1.1]heptane 3-oxide is sourced from PubChem (CID 156736532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).