About N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde
N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde (PubChem CID 156736903) has the molecular formula C9H21N3O
and a molecular weight of 187.29 g/mol. Its IUPAC name is N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde |
| PubChem CID | 156736903 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde |
| SMILES | CN(C)C.CNN1CCC(C=O)C1 |
| InChI | InChI=1S/C6H12N2O.C3H9N/c1-7-8-3-2-6(4-8)5-9;1-4(2)3/h5-7H,2-4H2,1H3;1-3H3 |
| InChIKey | QLKBIDKOCUUBMS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde?
The IUPAC name of N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde (CID 156736903) is N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde.
What is the SMILES notation for N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde?
The canonical SMILES for N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde is CN(C)C.CNN1CCC(C=O)C1.
What is the InChIKey of N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde?
The InChIKey is QLKBIDKOCUUBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C3H9N/c1-7-8-3-2-6(4-8)5-9;1-4(2)3/h5-7H,2-4H2,1H3;1-3H3.
What are the key properties of N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde?
N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde has a molecular weight of 187.29 g/mol, XLogP of -0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;1-(methylamino)pyrrolidine-3-carbaldehyde is sourced from PubChem (CID 156736903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).