About 7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one
7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one (PubChem CID 156737005) has the molecular formula C8H13FN2O
and a molecular weight of 172.20 g/mol. Its IUPAC name is 7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one.
Molecular Properties
| Compound Name | 7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one |
| PubChem CID | 156737005 |
| Molecular Formula | C8H13FN2O |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one |
| SMILES | CN1CCC2(CCN(F)C2)C1=O |
| InChI | InChI=1S/C8H13FN2O/c1-10-4-2-8(7(10)12)3-5-11(9)6-8/h2-6H2,1H3 |
| InChIKey | MSJRPQZZKLLIPT-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one?
The IUPAC name of 7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one (CID 156737005) is 7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one.
What is the SMILES notation for 7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one?
The canonical SMILES for 7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one is CN1CCC2(CCN(F)C2)C1=O.
What is the InChIKey of 7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one?
The InChIKey is MSJRPQZZKLLIPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13FN2O/c1-10-4-2-8(7(10)12)3-5-11(9)6-8/h2-6H2,1H3.
What are the key properties of 7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one?
7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one has a molecular weight of 172.20 g/mol, XLogP of 0.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2-methyl-2,7-diazaspiro[4.4]nonan-1-one is sourced from PubChem (CID 156737005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).