C23H23BF3N5O2 — CID 156737295
CID 156737295 (PubChem CID 156737295) has the molecular formula C23H23BF3N5O2 and a molecular weight of 469.28 g/mol.
| Compound Name | CID 156737295 |
|---|---|
| PubChem CID | 156737295 |
| Molecular Formula | C23H23BF3N5O2 |
| Molecular Weight | 469.28 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1CCC(c2cc3c(N(C)Cc4cccc(C(F)F)c4F)ncnc3n(C)c2=O)CC1 |
| InChI | InChI=1S/C23H23BF3N5O2/c1-30(11-14-4-3-5-15(18(14)25)19(26)27)20-17-10-16(13-6-8-32(9-7-13)23(24)34)22(33)31(2)21(17)29-12-28-20/h3-5,10,12-13,19H,6-9,11H2,1-2H3 |
| InChIKey | HLUVTROEJZTBMT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|